C21H24N2O4S — CID 6445639
(E)-but-2-enedioic acid;N,N-dimethyl-3-thieno[3,2-b][1]benzazepin-10-ylpropan-1-amine (PubChem CID 6445639) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N,N-dimethyl-3-thieno[3,2-b][1]benzazepin-10-ylpropan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N,N-dimethyl-3-thieno[3,2-b][1]benzazepin-10-ylpropan-1-amine |
|---|---|
| PubChem CID | 6445639 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (E)-but-2-enedioic acid;N,N-dimethyl-3-thieno[3,2-b][1]benzazepin-10-ylpropan-1-amine |
| SMILES | CN(C)CCCN1c2ccccc2C=Cc2sccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H20N2S.C4H4O4/c1-18(2)11-5-12-19-15-7-4-3-6-14(15)8-9-17-16(19)10-13-20-17;5-3(6)1-2-4(7)8/h3-4,6-10,13H,5,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IFLSTCGIWGZRTR-WLHGVMLRSA-N |
| XLogP | 4.03 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|