About (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol
(E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol (PubChem CID 6445654) has the molecular formula C26H22O2S
and a molecular weight of 398.53 g/mol. Its IUPAC name is (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol |
| PubChem CID | 6445654 |
| Molecular Formula | C26H22O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol |
| SMILES | O=S(CC(O)(/C=C/c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H22O2S/c27-26(24-13-5-2-6-14-24,18-17-21-9-3-1-4-10-21)20-29(28)25-16-15-22-11-7-8-12-23(22)19-25/h1-19,27H,20H2/b18-17+ |
| InChIKey | ZITNXERSGGHHRA-ISLYRVAYSA-N |
| XLogP | 5.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol?
The IUPAC name of (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol (CID 6445654) is (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol.
What is the SMILES notation for (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol?
The canonical SMILES for (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol is O=S(CC(O)(/C=C/c1ccccc1)c1ccccc1)c1ccc2ccccc2c1.
What is the InChIKey of (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol?
The InChIKey is ZITNXERSGGHHRA-ISLYRVAYSA-N. The full InChI is InChI=1S/C26H22O2S/c27-26(24-13-5-2-6-14-24,18-17-21-9-3-1-4-10-21)20-29(28)25-16-15-22-11-7-8-12-23(22)19-25/h1-19,27H,20H2/b18-17+.
What are the key properties of (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol?
(E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol has a molecular weight of 398.53 g/mol, XLogP of 5.55, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-naphthalen-2-ylsulfinyl-2,4-diphenylbut-3-en-2-ol is sourced from PubChem (CID 6445654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).