C30H34N2O11 — CID 6445685
bis((E)-but-2-enedioic acid);1-methyl-4-(spiro[1,3-dioxolane-2,11'-6H-benzo[c][1]benzoxepine]-4-ylmethyl)piperazine (PubChem CID 6445685) has the molecular formula C30H34N2O11 and a molecular weight of 598.61 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-methyl-4-(spiro[1,3-dioxolane-2,11'-6H-benzo[c][1]benzoxepine]-4-ylmethyl)piperazine.
| Compound Name | bis((E)-but-2-enedioic acid);1-methyl-4-(spiro[1,3-dioxolane-2,11'-6H-benzo[c][1]benzoxepine]-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 6445685 |
| Molecular Formula | C30H34N2O11 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-methyl-4-(spiro[1,3-dioxolane-2,11'-6H-benzo[c][1]benzoxepine]-4-ylmethyl)piperazine |
| SMILES | CN1CCN(CC2COC3(O2)c2ccccc2COc2ccccc23)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H26N2O3.2C4H4O4/c1-23-10-12-24(13-11-23)14-18-16-26-22(27-18)19-7-3-2-6-17(19)15-25-21-9-5-4-8-20(21)22;2*5-3(6)1-2-4(7)8/h2-9,18H,10-16H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | OIWMXOXKUZXIQW-LVEZLNDCSA-N |
| XLogP | 1.87 |
| TPSA | 183.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|