About bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine
bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine (PubChem CID 6445710) has the molecular formula C28H34N2O8
and a molecular weight of 526.59 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine.
Molecular Properties
| Compound Name | bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine |
| PubChem CID | 6445710 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine |
| SMILES | CN1CCN(C(CCc2ccccc2)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H26N2.2C4H4O4/c1-21-14-16-22(17-15-21)20(19-10-6-3-7-11-19)13-12-18-8-4-2-5-9-18;2*5-3(6)1-2-4(7)8/h2-11,20H,12-17H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | UGEPQDFUFWUBDJ-LVEZLNDCSA-N |
| XLogP | 3.03 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine?
The IUPAC name of bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine (CID 6445710) is bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine.
What is the SMILES notation for bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine?
The canonical SMILES for bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine is CN1CCN(C(CCc2ccccc2)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine?
The InChIKey is UGEPQDFUFWUBDJ-LVEZLNDCSA-N. The full InChI is InChI=1S/C20H26N2.2C4H4O4/c1-21-14-16-22(17-15-21)20(19-10-6-3-7-11-19)13-12-18-8-4-2-5-9-18;2*5-3(6)1-2-4(7)8/h2-11,20H,12-17H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+.
What are the key properties of bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine?
bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine has a molecular weight of 526.59 g/mol, XLogP of 3.03, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-but-2-enedioic acid);1-(1,3-diphenylpropyl)-4-methylpiperazine is sourced from PubChem (CID 6445710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).