C19H34N2 — CID 6445849
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine (PubChem CID 6445849) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
|---|---|
| PubChem CID | 6445849 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCNCC1 |
| InChI | InChI=1S/C19H34N2/c1-17(2)7-5-8-18(3)9-6-10-19(4)11-14-21-15-12-20-13-16-21/h7,9,11,20H,5-6,8,10,12-16H2,1-4H3/b18-9+,19-11+ |
| InChIKey | LUESRGDNECYQIC-ZYCAGONGSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|