C22H32N2O5 — CID 6445886
(Z)-2-methylbut-2-enedioic acid;2-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanol (PubChem CID 6445886) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is (Z)-2-methylbut-2-enedioic acid;2-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanol.
| Compound Name | (Z)-2-methylbut-2-enedioic acid;2-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 6445886 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (Z)-2-methylbut-2-enedioic acid;2-[4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazin-1-yl]ethanol |
| SMILES | C/C(=C/C(=O)O)C(=O)O.OCCN1CCN(c2ccc3c(c2)CCCCC3)CC1 |
| InChI | InChI=1S/C17H26N2O.C5H6O4/c20-13-12-18-8-10-19(11-9-18)17-7-6-15-4-2-1-3-5-16(15)14-17;1-3(5(8)9)2-4(6)7/h6-7,14,20H,1-5,8-13H2;2H,1H3,(H,6,7)(H,8,9)/b;3-2- |
| InChIKey | KNBZYODQZIYRFY-AHNKWOMYSA-N |
| XLogP | 2.17 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|