About (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one
(E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one (PubChem CID 6445960) has the molecular formula C19H23FN2O6
and a molecular weight of 394.40 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one |
| PubChem CID | 6445960 |
| Molecular Formula | C19H23FN2O6 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one |
| SMILES | CCN(CC)CCc1oc(=O)[nH]c1-c1ccc(F)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H19FN2O2.C4H4O4/c1-3-18(4-2)10-9-13-14(17-15(19)20-13)11-5-7-12(16)8-6-11;5-3(6)1-2-4(7)8/h5-8H,3-4,9-10H2,1-2H3,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JMQQUWXGUWTVIF-WLHGVMLRSA-N |
| XLogP | 2.37 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one?
The IUPAC name of (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one (CID 6445960) is (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one.
What is the SMILES notation for (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one?
The canonical SMILES for (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one is CCN(CC)CCc1oc(=O)[nH]c1-c1ccc(F)cc1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one?
The InChIKey is JMQQUWXGUWTVIF-WLHGVMLRSA-N. The full InChI is InChI=1S/C15H19FN2O2.C4H4O4/c1-3-18(4-2)10-9-13-14(17-15(19)20-13)11-5-7-12(16)8-6-11;5-3(6)1-2-4(7)8/h5-8H,3-4,9-10H2,1-2H3,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one?
(E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one has a molecular weight of 394.40 g/mol, XLogP of 2.37, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-3H-1,3-oxazol-2-one is sourced from PubChem (CID 6445960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).