C25H30N2O5S2 — CID 6446020
(E)-but-2-enedioic acid;1-(8-methoxy-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine (PubChem CID 6446020) has the molecular formula C25H30N2O5S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(8-methoxy-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(8-methoxy-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 6446020 |
| Molecular Formula | C25H30N2O5S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(8-methoxy-3-methylsulfanyl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine |
| SMILES | COc1ccc2c(c1)CC(N1CCN(C)CC1)c1cc(SC)ccc1S2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H26N2OS2.C4H4O4/c1-22-8-10-23(11-9-22)19-13-15-12-16(24-2)4-6-20(15)26-21-7-5-17(25-3)14-18(19)21;5-3(6)1-2-4(7)8/h4-7,12,14,19H,8-11,13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BSVPOQCQZNSXHP-WLHGVMLRSA-N |
| XLogP | 4.12 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|