C18H30O3 — CID 6446027
(9Z,11E)-13-oxooctadeca-9,11-dienoic acid (PubChem CID 6446027) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is (9Z,11E)-13-oxooctadeca-9,11-dienoic acid.
| Compound Name | (9Z,11E)-13-oxooctadeca-9,11-dienoic acid |
|---|---|
| PubChem CID | 6446027 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (9Z,11E)-13-oxooctadeca-9,11-dienoic acid |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h7,9,12,15H,2-6,8,10-11,13-14,16H2,1H3,(H,20,21)/b9-7-,15-12+ |
| InChIKey | JHXAZBBVQSRKJR-BSZOFBHHSA-N |
| XLogP | 5.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|