C18H18FNO4S — CID 6446145
(E)-but-2-enedioic acid;5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 6446145) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | (E)-but-2-enedioic acid;5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 6446145 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | Fc1ccccc1CN1CCc2sccc2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H14FNS.C4H4O4/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14;5-3(6)1-2-4(7)8/h1-4,6,8H,5,7,9-10H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XVMRVHZFXISCGL-WLHGVMLRSA-N |
| XLogP | 3.16 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|