C34H58N2 — CID 6446208
1,4-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine (PubChem CID 6446208) has the molecular formula C34H58N2 and a molecular weight of 494.85 g/mol. Its IUPAC name is 1,4-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine.
| Compound Name | 1,4-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
|---|---|
| PubChem CID | 6446208 |
| Molecular Formula | C34H58N2 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.46 |
| IUPAC Name | 1,4-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCN(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C34H58N2/c1-29(2)13-9-15-31(5)17-11-19-33(7)21-23-35-25-27-36(28-26-35)24-22-34(8)20-12-18-32(6)16-10-14-30(3)4/h13-14,17-18,21-22H,9-12,15-16,19-20,23-28H2,1-8H3/b31-17+,32-18+,33-21+,34-22+ |
| InChIKey | YQDADZNIKYLCSK-OGXBVDAXSA-N |
| XLogP | 9.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|