C25H37N — CID 6446214
(2E,6E)-N,3,7,11-tetramethyl-N-[(E)-3-phenylprop-2-enyl]dodeca-2,6,10-trien-1-amine (PubChem CID 6446214) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (2E,6E)-N,3,7,11-tetramethyl-N-[(E)-3-phenylprop-2-enyl]dodeca-2,6,10-trien-1-amine.
| Compound Name | (2E,6E)-N,3,7,11-tetramethyl-N-[(E)-3-phenylprop-2-enyl]dodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 6446214 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (2E,6E)-N,3,7,11-tetramethyl-N-[(E)-3-phenylprop-2-enyl]dodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN(C)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H37N/c1-22(2)12-9-13-23(3)14-10-15-24(4)19-21-26(5)20-11-18-25-16-7-6-8-17-25/h6-8,11-12,14,16-19H,9-10,13,15,20-21H2,1-5H3/b18-11+,23-14+,24-19+ |
| InChIKey | DUXXMKJBKFTNTG-ZNZUMIGKSA-N |
| XLogP | 7.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|