About (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid
(3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 644622) has the molecular formula C22H25FN2O7
and a molecular weight of 448.45 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| PubChem CID | 644622 |
| Molecular Formula | C22H25FN2O7 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(Cc3cccc(F)c3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23FN2O3.C2H2O4/c1-25-18-11-16(12-19(13-18)26-2)20(24)23-8-6-22(7-9-23)14-15-4-3-5-17(21)10-15;3-1(4)2(5)6/h3-5,10-13H,6-9,14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IUUGJCFQBVTYNU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid?
The IUPAC name of (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid (CID 644622) is (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
What is the SMILES notation for (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid?
The canonical SMILES for (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid is COc1cc(OC)cc(C(=O)N2CCN(Cc3cccc(F)c3)CC2)c1.O=C(O)C(=O)O.
What is the InChIKey of (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid?
The InChIKey is IUUGJCFQBVTYNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O3.C2H2O4/c1-25-18-11-16(12-19(13-18)26-2)20(24)23-8-6-22(7-9-23)14-15-4-3-5-17(21)10-15;3-1(4)2(5)6/h3-5,10-13H,6-9,14H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid?
(3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid has a molecular weight of 448.45 g/mol, XLogP of 1.96, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone;oxalic acid is sourced from PubChem (CID 644622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).