C25H29FN2O6S — CID 6446342
(E)-but-2-enedioic acid;2-[4-(3-fluoro-8-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]ethanol (PubChem CID 6446342) has the molecular formula C25H29FN2O6S and a molecular weight of 504.58 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[4-(3-fluoro-8-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]ethanol.
| Compound Name | (E)-but-2-enedioic acid;2-[4-(3-fluoro-8-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 6446342 |
| Molecular Formula | C25H29FN2O6S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[4-(3-fluoro-8-methoxy-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]ethanol |
| SMILES | COc1ccc2c(c1)CC(N1CCN(CCO)CC1)c1cc(F)ccc1S2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H25FN2O2S.C4H4O4/c1-26-17-3-5-20-15(12-17)13-19(18-14-16(22)2-4-21(18)27-20)24-8-6-23(7-9-24)10-11-25;5-3(6)1-2-4(7)8/h2-5,12,14,19,25H,6-11,13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MMQGKEQQCKTIIE-WLHGVMLRSA-N |
| XLogP | 2.90 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|