About bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine
bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine (PubChem CID 6446351) has the molecular formula C25H31N3O8
and a molecular weight of 501.54 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine |
| PubChem CID | 6446351 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine |
| SMILES | NCCCN1CCN(c2ccc3ccccc3c2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H23N3.2C4H4O4/c18-8-3-9-19-10-12-20(13-11-19)17-7-6-15-4-1-2-5-16(15)14-17;2*5-3(6)1-2-4(7)8/h1-2,4-7,14H,3,8-13,18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | JSDRLRXDMOIBTC-LVEZLNDCSA-N |
| XLogP | 1.73 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine?
The IUPAC name of bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine (CID 6446351) is bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine.
What is the SMILES notation for bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine?
The canonical SMILES for bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine is NCCCN1CCN(c2ccc3ccccc3c2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine?
The InChIKey is JSDRLRXDMOIBTC-LVEZLNDCSA-N. The full InChI is InChI=1S/C17H23N3.2C4H4O4/c18-8-3-9-19-10-12-20(13-11-19)17-7-6-15-4-1-2-5-16(15)14-17;2*5-3(6)1-2-4(7)8/h1-2,4-7,14H,3,8-13,18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+.
What are the key properties of bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine?
bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine has a molecular weight of 501.54 g/mol, XLogP of 1.73, 8 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-but-2-enedioic acid);3-(4-naphthalen-2-ylpiperazin-1-yl)propan-1-amine is sourced from PubChem (CID 6446351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).