C21H26N2O4 — CID 6446436
(E)-but-2-enedioic acid;(2S)-1-(4,4,7-trimethylindeno[1,2-b]pyrrol-1-yl)propan-2-amine (PubChem CID 6446436) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-1-(4,4,7-trimethylindeno[1,2-b]pyrrol-1-yl)propan-2-amine.
| Compound Name | (E)-but-2-enedioic acid;(2S)-1-(4,4,7-trimethylindeno[1,2-b]pyrrol-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 6446436 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-1-(4,4,7-trimethylindeno[1,2-b]pyrrol-1-yl)propan-2-amine |
| SMILES | Cc1ccc2c(c1)-c1c(ccn1C[C@H](C)N)C2(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H22N2.C4H4O4/c1-11-5-6-14-13(9-11)16-15(17(14,3)4)7-8-19(16)10-12(2)18;5-3(6)1-2-4(7)8/h5-9,12H,10,18H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-;/m0./s1 |
| InChIKey | SACMXZDUZMBKSI-GYDOPSIJSA-N |
| XLogP | 3.16 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|