C35H43N5O10 — CID 6446461
bis((E)-but-2-enedioic acid);N-butyl-2-[4-[[1-(3-oxo-3-phenylpropyl)benzimidazol-2-yl]methyl]piperazin-1-yl]acetamide (PubChem CID 6446461) has the molecular formula C35H43N5O10 and a molecular weight of 693.75 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);N-butyl-2-[4-[[1-(3-oxo-3-phenylpropyl)benzimidazol-2-yl]methyl]piperazin-1-yl]acetamide.
| Compound Name | bis((E)-but-2-enedioic acid);N-butyl-2-[4-[[1-(3-oxo-3-phenylpropyl)benzimidazol-2-yl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6446461 |
| Molecular Formula | C35H43N5O10 |
| Molecular Weight | 693.75 g/mol |
| Exact Mass | 693.30 |
| IUPAC Name | bis((E)-but-2-enedioic acid);N-butyl-2-[4-[[1-(3-oxo-3-phenylpropyl)benzimidazol-2-yl]methyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(Cc2nc3ccccc3n2CCC(=O)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C27H35N5O2.2C4H4O4/c1-2-3-14-28-27(34)21-31-18-16-30(17-19-31)20-26-29-23-11-7-8-12-24(23)32(26)15-13-25(33)22-9-5-4-6-10-22;2*5-3(6)1-2-4(7)8/h4-12H,2-3,13-21H2,1H3,(H,28,34);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | BWGLUJPXEQNMEA-LVEZLNDCSA-N |
| XLogP | 2.77 |
| TPSA | 219.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|