C20H34O4 — CID 6446552
7-[(1R,2R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]heptanal (PubChem CID 6446552) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 7-[(1R,2R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]heptanal.
| Compound Name | 7-[(1R,2R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]heptanal |
|---|---|
| PubChem CID | 6446552 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 7-[(1R,2R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopent-3-en-1-yl]heptanal |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(O)=C[C@H](O)[C@@H]1CCCCCCC=O |
| InChI | InChI=1S/C20H34O4/c1-2-3-7-10-16(22)12-13-18-17(19(23)15-20(18)24)11-8-5-4-6-9-14-21/h12-19,22-24H,2-11H2,1H3/b13-12+/t16-,17+,18+,19-/m0/s1 |
| InChIKey | FBBXWGIKAQEMHO-KENJKRGESA-N |
| XLogP | 4.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|