About (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride
(4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride (PubChem CID 6446581) has the molecular formula C25H38ClNO2
and a molecular weight of 420.04 g/mol. Its IUPAC name is (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride.
Molecular Properties
| Compound Name | (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
| PubChem CID | 6446581 |
| Molecular Formula | C25H38ClNO2 |
| Molecular Weight | 420.04 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
| SMILES | C/C(=C\C[N+]1(CC(=O)OC2CCC(C)CC2)CCCCC1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H38NO2.ClH/c1-21-11-13-24(14-12-21)28-25(27)20-26(16-7-4-8-17-26)18-15-22(2)19-23-9-5-3-6-10-23;/h3,5-6,9-10,15,21,24H,4,7-8,11-14,16-20H2,1-2H3;1H/q+1;/p-1/b22-15+; |
| InChIKey | MKHQEMYNHUSWKF-WXXHTBLMSA-M |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.04 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride?
The IUPAC name of (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride (CID 6446581) is (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride.
What is the SMILES notation for (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride?
The canonical SMILES for (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride is C/C(=C\C[N+]1(CC(=O)OC2CCC(C)CC2)CCCCC1)Cc1ccccc1.[Cl-].
What is the InChIKey of (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride?
The InChIKey is MKHQEMYNHUSWKF-WXXHTBLMSA-M. The full InChI is InChI=1S/C25H38NO2.ClH/c1-21-11-13-24(14-12-21)28-25(27)20-26(16-7-4-8-17-26)18-15-22(2)19-23-9-5-3-6-10-23;/h3,5-6,9-10,15,21,24H,4,7-8,11-14,16-20H2,1-2H3;1H/q+1;/p-1/b22-15+;.
What are the key properties of (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride?
(4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride has a molecular weight of 420.04 g/mol, XLogP of 2.30, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl) 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride is sourced from PubChem (CID 6446581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).