C20H29NO13 — CID 6446660
bis((2R,3R)-2,3-dihydroxybutanedioic acid);3,4-dimethyl-2-phenylmorpholine (PubChem CID 6446660) has the molecular formula C20H29NO13 and a molecular weight of 491.45 g/mol. Its IUPAC name is bis((2R,3R)-2,3-dihydroxybutanedioic acid);3,4-dimethyl-2-phenylmorpholine.
| Compound Name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);3,4-dimethyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 6446660 |
| Molecular Formula | C20H29NO13 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);3,4-dimethyl-2-phenylmorpholine |
| SMILES | CC1C(c2ccccc2)OCCN1C.O=C(O)[C@H](O)[C@@H](O)C(=O)O.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C12H17NO.2C4H6O6/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;2*5-1(3(7)8)2(6)4(9)10/h3-7,10,12H,8-9H2,1-2H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t;2*1-,2-/m.11/s1 |
| InChIKey | BCCGKQFZUUQSEX-WBPXWQEISA-N |
| XLogP | -2.17 |
| TPSA | 242.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |