About (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one)
(E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) (PubChem CID 6446754) has the molecular formula C36H34N2O10
and a molecular weight of 654.67 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one).
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) |
| PubChem CID | 6446754 |
| Molecular Formula | C36H34N2O10 |
| Molecular Weight | 654.67 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) |
| SMILES | COc1ccc(C(=O)/C=C\c2ccncc2)c(OC)c1.COc1ccc(C(=O)/C=C\c2ccncc2)c(OC)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C16H15NO3.C4H4O4/c2*1-19-13-4-5-14(16(11-13)20-2)15(18)6-3-12-7-9-17-10-8-12;5-3(6)1-2-4(7)8/h2*3-11H,1-2H3;1-2H,(H,5,6)(H,7,8)/b2*6-3-;2-1+ |
| InChIKey | XGRJEEWHDQOFAZ-NWDFUMCASA-N |
| XLogP | 5.70 |
| TPSA | 171.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 654.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one)?
The IUPAC name of (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) (CID 6446754) is (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one).
What is the SMILES notation for (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one)?
The canonical SMILES for (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) is COc1ccc(C(=O)/C=C\c2ccncc2)c(OC)c1.COc1ccc(C(=O)/C=C\c2ccncc2)c(OC)c1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one)?
The InChIKey is XGRJEEWHDQOFAZ-NWDFUMCASA-N. The full InChI is InChI=1S/2C16H15NO3.C4H4O4/c2*1-19-13-4-5-14(16(11-13)20-2)15(18)6-3-12-7-9-17-10-8-12;5-3(6)1-2-4(7)8/h2*3-11H,1-2H3;1-2H,(H,5,6)(H,7,8)/b2*6-3-;2-1+.
What are the key properties of (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one)?
(E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) has a molecular weight of 654.67 g/mol, XLogP of 5.70, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;bis((Z)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one) is sourced from PubChem (CID 6446754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).