About (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride
(3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 6446777) has the molecular formula C18H18Cl2FNS
and a molecular weight of 370.32 g/mol. Its IUPAC name is (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| PubChem CID | 6446777 |
| Molecular Formula | C18H18Cl2FNS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CC/C=C1/c2ccc(F)cc2Sc2ccc(Cl)cc21.Cl |
| InChI | InChI=1S/C18H17ClFNS.ClH/c1-21(2)9-3-4-14-15-7-6-13(20)11-18(15)22-17-8-5-12(19)10-16(14)17;/h4-8,10-11H,3,9H2,1-2H3;1H/b14-4-; |
| InChIKey | OSDYYIHCOCODMF-CYBPKNTASA-N |
| XLogP | 5.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The IUPAC name of (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride (CID 6446777) is (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride.
What is the SMILES notation for (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The canonical SMILES for (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride is CN(C)CC/C=C1/c2ccc(F)cc2Sc2ccc(Cl)cc21.Cl.
What is the InChIKey of (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The InChIKey is OSDYYIHCOCODMF-CYBPKNTASA-N. The full InChI is InChI=1S/C18H17ClFNS.ClH/c1-21(2)9-3-4-14-15-7-6-13(20)11-18(15)22-17-8-5-12(19)10-16(14)17;/h4-8,10-11H,3,9H2,1-2H3;1H/b14-4-;.
What are the key properties of (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
(3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride has a molecular weight of 370.32 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride is sourced from PubChem (CID 6446777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).