C19H33NO — CID 6446852
4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]morpholine (PubChem CID 6446852) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]morpholine.
| Compound Name | 4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]morpholine |
|---|---|
| PubChem CID | 6446852 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]morpholine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCOCC1 |
| InChI | InChI=1S/C19H33NO/c1-17(2)7-5-8-18(3)9-6-10-19(4)11-12-20-13-15-21-16-14-20/h7,9,11H,5-6,8,10,12-16H2,1-4H3/b18-9+,19-11+ |
| InChIKey | SNDOFKPAIDYDBN-ZYCAGONGSA-N |
| XLogP | 4.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|