C22H38N2 — CID 6446858
1-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine (PubChem CID 6446858) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine.
| Compound Name | 1-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
|---|---|
| PubChem CID | 6446858 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 1-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
| SMILES | C=CCN1CCN(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C22H38N2/c1-6-14-23-16-18-24(19-17-23)15-13-22(5)12-8-11-21(4)10-7-9-20(2)3/h6,9,11,13H,1,7-8,10,12,14-19H2,2-5H3/b21-11+,22-13+ |
| InChIKey | YCBSKSDBGSCAIW-ZGRPYONQSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|