C20H35N — CID 6446865
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidine (PubChem CID 6446865) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidine.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidine |
|---|---|
| PubChem CID | 6446865 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperidine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCCCC1 |
| InChI | InChI=1S/C20H35N/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-17-21-15-6-5-7-16-21/h10,12,14H,5-9,11,13,15-17H2,1-4H3/b19-12+,20-14+ |
| InChIKey | QZPMEHRLRWYEEH-LCAIAVFMSA-N |
| XLogP | 5.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|