C25H43N3O2 — CID 6446870
2-morpholin-4-yl-1-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethanone (PubChem CID 6446870) has the molecular formula C25H43N3O2 and a molecular weight of 417.64 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethanone.
| Compound Name | 2-morpholin-4-yl-1-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 6446870 |
| Molecular Formula | C25H43N3O2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 2-morpholin-4-yl-1-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethanone |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCN(C(=O)CN2CCOCC2)CC1 |
| InChI | InChI=1S/C25H43N3O2/c1-22(2)7-5-8-23(3)9-6-10-24(4)11-12-26-13-15-28(16-14-26)25(29)21-27-17-19-30-20-18-27/h7,9,11H,5-6,8,10,12-21H2,1-4H3/b23-9+,24-11+ |
| InChIKey | GRRHKPVBQKPSMY-YQHSNOJUSA-N |
| XLogP | 3.88 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|