C25H38N2 — CID 6446873
1-phenyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine (PubChem CID 6446873) has the molecular formula C25H38N2 and a molecular weight of 366.59 g/mol. Its IUPAC name is 1-phenyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine.
| Compound Name | 1-phenyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
|---|---|
| PubChem CID | 6446873 |
| Molecular Formula | C25H38N2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 1-phenyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H38N2/c1-22(2)10-8-11-23(3)12-9-13-24(4)16-17-26-18-20-27(21-19-26)25-14-6-5-7-15-25/h5-7,10,12,14-16H,8-9,11,13,17-21H2,1-4H3/b23-12+,24-16+ |
| InChIKey | FACYKKRQGSLMGT-VFAYVSIVSA-N |
| XLogP | 6.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|