C23H36N4 — CID 6446876
2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]pyrimidine (PubChem CID 6446876) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 6446876 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]pyrimidine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H36N4/c1-20(2)8-5-9-21(3)10-6-11-22(4)12-15-26-16-18-27(19-17-26)23-24-13-7-14-25-23/h7-8,10,12-14H,5-6,9,11,15-19H2,1-4H3/b21-10+,22-12+ |
| InChIKey | ZXAITSKBYKBVRJ-KZVLYIKRSA-N |
| XLogP | 5.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|