C28H35NO5 — CID 6446881
N-benzyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylmethoxymethyl)propan-2-amine;(Z)-but-2-enedioic acid (PubChem CID 6446881) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-benzyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylmethoxymethyl)propan-2-amine;(Z)-but-2-enedioic acid.
| Compound Name | N-benzyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylmethoxymethyl)propan-2-amine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 6446881 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-benzyl-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylmethoxymethyl)propan-2-amine;(Z)-but-2-enedioic acid |
| SMILES | CC(C)N(COCc1c2c(cc3c1CCC3)CCC2)Cc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H31NO.C4H4O4/c1-18(2)25(15-19-8-4-3-5-9-19)17-26-16-24-22-12-6-10-20(22)14-21-11-7-13-23(21)24;5-3(6)1-2-4(7)8/h3-5,8-9,14,18H,6-7,10-13,15-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DQDSRENDAFIQNU-BTJKTKAUSA-N |
| XLogP | 4.76 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|