C53H84O2 — CID 6447059
[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] prop-2-enoate (PubChem CID 6447059) has the molecular formula C53H84O2 and a molecular weight of 753.25 g/mol. Its IUPAC name is [(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] prop-2-enoate.
| Compound Name | [(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] prop-2-enoate |
|---|---|
| PubChem CID | 6447059 |
| Molecular Formula | C53H84O2 |
| Molecular Weight | 753.25 g/mol |
| Exact Mass | 752.65 |
| IUPAC Name | [(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaenyl] prop-2-enoate |
| SMILES | C=CC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C53H84O2/c1-13-53(54)55-42-41-52(12)40-22-39-51(11)38-21-37-50(10)36-20-35-49(9)34-19-33-48(8)32-18-31-47(7)30-17-29-46(6)28-16-27-45(5)26-15-25-44(4)24-14-23-43(2)3/h13,23,25,27,29,31,33,35,37,39,41H,1,14-22,24,26,28,30,32,34,36,38,40,42H2,2-12H3/b44-25+,45-27+,46-29+,47-31+,48-33+,49-35+,50-37+,51-39+,52-41+ |
| InChIKey | ZFPAYOGHSALADL-AVRCVIBKSA-N |
| XLogP | 17.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.25 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|