C18H33NO6 — CID 6447189
(E)-but-2-enedioic acid;1-cyclooctyloxy-3-(propan-2-ylamino)propan-2-ol (PubChem CID 6447189) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-cyclooctyloxy-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (E)-but-2-enedioic acid;1-cyclooctyloxy-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 6447189 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (E)-but-2-enedioic acid;1-cyclooctyloxy-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COC1CCCCCCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H29NO2.C4H4O4/c1-12(2)15-10-13(16)11-17-14-8-6-4-3-5-7-9-14;5-3(6)1-2-4(7)8/h12-16H,3-11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BIITYLBOUVUQLG-WLHGVMLRSA-N |
| XLogP | 2.19 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|