About N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide
N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 644725) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide.
Molecular Properties
| Compound Name | N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| PubChem CID | 644725 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)NC1CCCC1 |
| InChI | InChI=1S/C19H24N2O3/c22-17(20-14-8-3-4-9-14)12-2-1-7-13-21-18(23)15-10-5-6-11-16(15)19(21)24/h5-6,10-11,14H,1-4,7-9,12-13H2,(H,20,22) |
| InChIKey | MJWLPAVCJNZQGR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide?
The IUPAC name of N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide (CID 644725) is N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide.
What is the SMILES notation for N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide?
The canonical SMILES for N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide is O=C(CCCCCN1C(=O)c2ccccc2C1=O)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide?
The InChIKey is MJWLPAVCJNZQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3/c22-17(20-14-8-3-4-9-14)12-2-1-7-13-21-18(23)15-10-5-6-11-16(15)19(21)24/h5-6,10-11,14H,1-4,7-9,12-13H2,(H,20,22).
What are the key properties of N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide?
N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide has a molecular weight of 328.41 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-6-(1,3-dioxoisoindol-2-yl)hexanamide is sourced from PubChem (CID 644725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).