About (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine
(E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine (PubChem CID 6447635) has the molecular formula C16H23NO6
and a molecular weight of 325.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine |
| PubChem CID | 6447635 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)COc1ccccc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H19NO2.C4H4O4/c1-10(8-13-2)9-15-12-7-5-4-6-11(12)14-3;5-3(6)1-2-4(7)8/h4-7,10,13H,8-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OLWCGMQFGKGPJB-WLHGVMLRSA-N |
| XLogP | 1.64 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine?
The IUPAC name of (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine (CID 6447635) is (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine?
The canonical SMILES for (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine is CNCC(C)COc1ccccc1OC.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine?
The InChIKey is OLWCGMQFGKGPJB-WLHGVMLRSA-N. The full InChI is InChI=1S/C12H19NO2.C4H4O4/c1-10(8-13-2)9-15-12-7-5-4-6-11(12)14-3;5-3(6)1-2-4(7)8/h4-7,10,13H,8-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine?
(E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine has a molecular weight of 325.36 g/mol, XLogP of 1.64, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;3-(2-methoxyphenoxy)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 6447635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).