About 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate
2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate (PubChem CID 6447645) has the molecular formula C20H25NO3
and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate |
| PubChem CID | 6447645 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate |
| SMILES | Cc1ccc2c(c1)C1(C)C=C/C(=C\C(=O)OCCN(C)C)CC1O2 |
| InChI | InChI=1S/C20H25NO3/c1-14-5-6-17-16(11-14)20(2)8-7-15(12-18(20)24-17)13-19(22)23-10-9-21(3)4/h5-8,11,13,18H,9-10,12H2,1-4H3/b15-13+ |
| InChIKey | KLAJJCIIFWSFNY-FYWRMAATSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate?
The IUPAC name of 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate (CID 6447645) is 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate.
What is the SMILES notation for 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate?
The canonical SMILES for 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate is Cc1ccc2c(c1)C1(C)C=C/C(=C\C(=O)OCCN(C)C)CC1O2.
What is the InChIKey of 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate?
The InChIKey is KLAJJCIIFWSFNY-FYWRMAATSA-N. The full InChI is InChI=1S/C20H25NO3/c1-14-5-6-17-16(11-14)20(2)8-7-15(12-18(20)24-17)13-19(22)23-10-9-21(3)4/h5-8,11,13,18H,9-10,12H2,1-4H3/b15-13+.
What are the key properties of 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate?
2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate has a molecular weight of 327.42 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl (2Z)-2-(8,9b-dimethyl-4,4a-dihydrodibenzofuran-3-ylidene)acetate is sourced from PubChem (CID 6447645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).