C26H32N2O7 — CID 6447721
(2R,3R)-2,3-dihydroxybutanedioic acid;N-[2-[2-[(E)-2-(1H-indol-4-yl)ethenyl]phenoxy]ethyl]-2-methylpropan-2-amine (PubChem CID 6447721) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;N-[2-[2-[(E)-2-(1H-indol-4-yl)ethenyl]phenoxy]ethyl]-2-methylpropan-2-amine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;N-[2-[2-[(E)-2-(1H-indol-4-yl)ethenyl]phenoxy]ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 6447721 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;N-[2-[2-[(E)-2-(1H-indol-4-yl)ethenyl]phenoxy]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCOc1ccccc1/C=C/c1cccc2[nH]ccc12.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C22H26N2O.C4H6O6/c1-22(2,3)24-15-16-25-21-10-5-4-7-18(21)12-11-17-8-6-9-20-19(17)13-14-23-20;5-1(3(7)8)2(6)4(9)10/h4-14,23-24H,15-16H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/b12-11+;/t;1-,2-/m.1/s1 |
| InChIKey | OAAFOUPUPPKSKH-ZFEFYOJNSA-N |
| XLogP | 2.98 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|