About 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone
2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone (PubChem CID 644783) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone |
| PubChem CID | 644783 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N1CCCOC1 |
| InChI | InChI=1S/C16H25NO2/c18-15(17-2-1-3-19-11-17)10-16-7-12-4-13(8-16)6-14(5-12)9-16/h12-14H,1-11H2 |
| InChIKey | IAQFGCYDJGGEQR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone?
The IUPAC name of 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone (CID 644783) is 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone.
What is the SMILES notation for 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone?
The canonical SMILES for 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone is O=C(CC12CC3CC(CC(C3)C1)C2)N1CCCOC1.
What is the InChIKey of 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone?
The InChIKey is IAQFGCYDJGGEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c18-15(17-2-1-3-19-11-17)10-16-7-12-4-13(8-16)6-14(5-12)9-16/h12-14H,1-11H2.
What are the key properties of 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone?
2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone has a molecular weight of 263.38 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-1-(1,3-oxazinan-3-yl)ethanone is sourced from PubChem (CID 644783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).