About (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one
(E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 6447866) has the molecular formula C17H20F3NO
and a molecular weight of 311.35 g/mol. Its IUPAC name is (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| PubChem CID | 6447866 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CC1CCCC(C)N1C(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3NO/c1-12-4-3-5-13(2)21(12)16(22)11-8-14-6-9-15(10-7-14)17(18,19)20/h6-13H,3-5H2,1-2H3/b11-8+ |
| InChIKey | ZJQBYYSYRCUAFT-DHZHZOJOSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one?
The IUPAC name of (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (CID 6447866) is (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
What is the SMILES notation for (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one?
The canonical SMILES for (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one is CC1CCCC(C)N1C(=O)/C=C/c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one?
The InChIKey is ZJQBYYSYRCUAFT-DHZHZOJOSA-N. The full InChI is InChI=1S/C17H20F3NO/c1-12-4-3-5-13(2)21(12)16(22)11-8-14-6-9-15(10-7-14)17(18,19)20/h6-13H,3-5H2,1-2H3/b11-8+.
What are the key properties of (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one?
(E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one has a molecular weight of 311.35 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,6-dimethylpiperidin-1-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one is sourced from PubChem (CID 6447866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).