About (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine
(9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine (PubChem CID 6448038) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine.
Molecular Properties
| Compound Name | (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine |
| PubChem CID | 6448038 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine |
| SMILES | COc1ccc(/C=C2\c3ccccc3-c3cccnc32)cc1OC |
| InChI | InChI=1S/C21H17NO2/c1-23-19-10-9-14(13-20(19)24-2)12-18-16-7-4-3-6-15(16)17-8-5-11-22-21(17)18/h3-13H,1-2H3/b18-12+ |
| InChIKey | CZJOHSIFSRIVIQ-LDADJPATSA-N |
| XLogP | 4.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine?
The IUPAC name of (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine (CID 6448038) is (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine.
What is the SMILES notation for (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine?
The canonical SMILES for (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine is COc1ccc(/C=C2\c3ccccc3-c3cccnc32)cc1OC.
What is the InChIKey of (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine?
The InChIKey is CZJOHSIFSRIVIQ-LDADJPATSA-N. The full InChI is InChI=1S/C21H17NO2/c1-23-19-10-9-14(13-20(19)24-2)12-18-16-7-4-3-6-15(16)17-8-5-11-22-21(17)18/h3-13H,1-2H3/b18-12+.
What are the key properties of (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine?
(9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine has a molecular weight of 315.37 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-9-[(3,4-dimethoxyphenyl)methylidene]indeno[2,1-b]pyridine is sourced from PubChem (CID 6448038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).