C20H19F2NO2 — CID 644810
(4-fluorophenyl)-[3-(2-fluorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 644810) has the molecular formula C20H19F2NO2 and a molecular weight of 343.37 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-(2-fluorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (4-fluorophenyl)-[3-(2-fluorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 644810 |
| Molecular Formula | C20H19F2NO2 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (4-fluorophenyl)-[3-(2-fluorophenyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1C2CCC1CC(O)(c1ccccc1F)C2 |
| InChI | InChI=1S/C20H19F2NO2/c21-14-7-5-13(6-8-14)19(24)23-15-9-10-16(23)12-20(25,11-15)17-3-1-2-4-18(17)22/h1-8,15-16,25H,9-12H2 |
| InChIKey | GYQQNUGUMXRQHA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |