About N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid
N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid (PubChem CID 6448104) has the molecular formula C23H27NO6
and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid |
| PubChem CID | 6448104 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid |
| SMILES | CCC(C)NCCC1Oc2ccccc2Oc2ccccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H23NO2.C4H4O4/c1-3-14(2)20-13-12-17-15-8-4-5-9-16(15)21-18-10-6-7-11-19(18)22-17;5-3(6)1-2-4(7)8/h4-11,14,17,20H,3,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YUAZOJBHJAHNJC-WLHGVMLRSA-N |
| XLogP | 4.40 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid?
The IUPAC name of N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid (CID 6448104) is N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid.
What is the SMILES notation for N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid?
The canonical SMILES for N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid is CCC(C)NCCC1Oc2ccccc2Oc2ccccc21.O=C(O)/C=C/C(=O)O.
What is the InChIKey of N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid?
The InChIKey is YUAZOJBHJAHNJC-WLHGVMLRSA-N. The full InChI is InChI=1S/C19H23NO2.C4H4O4/c1-3-14(2)20-13-12-17-15-8-4-5-9-16(15)21-18-10-6-7-11-19(18)22-17;5-3(6)1-2-4(7)8/h4-11,14,17,20H,3,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid?
N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid has a molecular weight of 413.47 g/mol, XLogP of 4.40, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6H-benzo[b][1,4]benzodioxepin-6-yl)ethyl]butan-2-amine;(E)-but-2-enedioic acid is sourced from PubChem (CID 6448104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).