About bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate
bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate (PubChem CID 6448113) has the molecular formula C26H37N3O10
and a molecular weight of 551.59 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate |
| PubChem CID | 6448113 |
| Molecular Formula | C26H37N3O10 |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(CCN(C)C)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H29N3O2.2C4H4O4/c1-4-23-18(22)21-14-12-20(13-15-21)17(10-11-19(2)3)16-8-6-5-7-9-16;2*5-3(6)1-2-4(7)8/h5-9,17H,4,10-15H2,1-3H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | QBRHJCCFIRGALF-LVEZLNDCSA-N |
| XLogP | 1.88 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate?
The IUPAC name of bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate (CID 6448113) is bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate.
What is the SMILES notation for bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate?
The canonical SMILES for bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(CCN(C)C)c2ccccc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate?
The InChIKey is QBRHJCCFIRGALF-LVEZLNDCSA-N. The full InChI is InChI=1S/C18H29N3O2.2C4H4O4/c1-4-23-18(22)21-14-12-20(13-15-21)17(10-11-19(2)3)16-8-6-5-7-9-16;2*5-3(6)1-2-4(7)8/h5-9,17H,4,10-15H2,1-3H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+.
What are the key properties of bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate?
bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate has a molecular weight of 551.59 g/mol, XLogP of 1.88, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-but-2-enedioic acid);ethyl 4-[3-(dimethylamino)-1-phenylpropyl]piperazine-1-carboxylate is sourced from PubChem (CID 6448113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).