About tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine
tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine (PubChem CID 6448115) has the molecular formula C28H39N3O12
and a molecular weight of 609.63 g/mol. Its IUPAC name is tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine.
Molecular Properties
| Compound Name | tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine |
| PubChem CID | 6448115 |
| Molecular Formula | C28H39N3O12 |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine |
| SMILES | CN1CCN(CCC(c2ccccc2)N(C)C)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H27N3.3C4H4O4/c1-17(2)16(15-7-5-4-6-8-15)9-10-19-13-11-18(3)12-14-19;3*5-3(6)1-2-4(7)8/h4-8,16H,9-14H2,1-3H3;3*1-2H,(H,5,6)(H,7,8)/b;3*2-1+ |
| InChIKey | VETUAKXICZAPTN-LDFLFNBESA-N |
| XLogP | 1.06 |
| TPSA | 233.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine?
The IUPAC name of tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine (CID 6448115) is tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine.
What is the SMILES notation for tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine?
The canonical SMILES for tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine is CN1CCN(CCC(c2ccccc2)N(C)C)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine?
The InChIKey is VETUAKXICZAPTN-LDFLFNBESA-N. The full InChI is InChI=1S/C16H27N3.3C4H4O4/c1-17(2)16(15-7-5-4-6-8-15)9-10-19-13-11-18(3)12-14-19;3*5-3(6)1-2-4(7)8/h4-8,16H,9-14H2,1-3H3;3*1-2H,(H,5,6)(H,7,8)/b;3*2-1+.
What are the key properties of tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine?
tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine has a molecular weight of 609.63 g/mol, XLogP of 1.06, 11 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris((E)-but-2-enedioic acid);N,N-dimethyl-3-(4-methylpiperazin-1-yl)-1-phenylpropan-1-amine is sourced from PubChem (CID 6448115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).