About 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride
3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride (PubChem CID 6448182) has the molecular formula C8H18Cl2N6O2
and a molecular weight of 301.18 g/mol. Its IUPAC name is 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride |
| PubChem CID | 6448182 |
| Molecular Formula | C8H18Cl2N6O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride |
| SMILES | Cl.Cl.O.[H]/N=c1\nc(N2CCNCC2)cc(N)n1O |
| InChI | InChI=1S/C8H14N6O.2ClH.H2O/c9-6-5-7(12-8(10)14(6)15)13-3-1-11-2-4-13;;;/h5,10-11,15H,1-4,9H2;2*1H;1H2/b10-8+;;; |
| InChIKey | XRPIEPKBPLYOIV-WDMODZRLSA-N |
| XLogP | -1.39 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride?
The IUPAC name of 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride (CID 6448182) is 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride.
What is the SMILES notation for 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride?
The canonical SMILES for 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride is Cl.Cl.O.[H]/N=c1\nc(N2CCNCC2)cc(N)n1O.
What is the InChIKey of 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride?
The InChIKey is XRPIEPKBPLYOIV-WDMODZRLSA-N. The full InChI is InChI=1S/C8H14N6O.2ClH.H2O/c9-6-5-7(12-8(10)14(6)15)13-3-1-11-2-4-13;;;/h5,10-11,15H,1-4,9H2;2*1H;1H2/b10-8+;;;.
What are the key properties of 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride?
3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride has a molecular weight of 301.18 g/mol, XLogP of -1.39, 1 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-imino-6-piperazin-1-ylpyrimidin-4-amine;hydrate;dihydrochloride is sourced from PubChem (CID 6448182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).