C36H44N4O12 — CID 6448274
bis((E)-but-2-enedioic acid);[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] cyclohexanecarboxylate (PubChem CID 6448274) has the molecular formula C36H44N4O12 and a molecular weight of 724.76 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] cyclohexanecarboxylate.
| Compound Name | bis((E)-but-2-enedioic acid);[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 6448274 |
| Molecular Formula | C36H44N4O12 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | bis((E)-but-2-enedioic acid);[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] cyclohexanecarboxylate |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O.O=C(OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)C2C3C=CC(C3)C2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C28H36N4O4.2C4H4O4/c33-26-24-20-9-10-21(16-20)25(24)27(34)32(26)18-22(36-28(35)19-6-2-1-3-7-19)17-30-12-14-31(15-13-30)23-8-4-5-11-29-23;2*5-3(6)1-2-4(7)8/h4-5,8-11,19-22,24-25H,1-3,6-7,12-18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | OJRHMOGSWVPNGO-LVEZLNDCSA-N |
| XLogP | 1.93 |
| TPSA | 232.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|