About 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride
5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride (PubChem CID 6448480) has the molecular formula C20H27ClN2O2
and a molecular weight of 362.90 g/mol. Its IUPAC name is 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride |
| PubChem CID | 6448480 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride |
| SMILES | Cc1cc(/C=C/c2ccccc2OCCN2CCCCCC2)on1.Cl |
| InChI | InChI=1S/C20H26N2O2.ClH/c1-17-16-19(24-21-17)11-10-18-8-4-5-9-20(18)23-15-14-22-12-6-2-3-7-13-22;/h4-5,8-11,16H,2-3,6-7,12-15H2,1H3;1H/b11-10+; |
| InChIKey | SVZYXFNXKGAXNO-ASTDGNLGSA-N |
| XLogP | 4.83 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride?
The IUPAC name of 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride (CID 6448480) is 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride.
What is the SMILES notation for 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride?
The canonical SMILES for 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride is Cc1cc(/C=C/c2ccccc2OCCN2CCCCCC2)on1.Cl.
What is the InChIKey of 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride?
The InChIKey is SVZYXFNXKGAXNO-ASTDGNLGSA-N. The full InChI is InChI=1S/C20H26N2O2.ClH/c1-17-16-19(24-21-17)11-10-18-8-4-5-9-20(18)23-15-14-22-12-6-2-3-7-13-22;/h4-5,8-11,16H,2-3,6-7,12-15H2,1H3;1H/b11-10+;.
What are the key properties of 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride?
5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride has a molecular weight of 362.90 g/mol, XLogP of 4.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-[2-[2-(azepan-1-yl)ethoxy]phenyl]ethenyl]-3-methyl-1,2-oxazole;hydrochloride is sourced from PubChem (CID 6448480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).