C20H31N3O8S — CID 644864
2-(3-ethoxypropylamino)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone;oxalic acid (PubChem CID 644864) has the molecular formula C20H31N3O8S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 2-(3-ethoxypropylamino)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 644864 |
| Molecular Formula | C20H31N3O8S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-(3-ethoxypropylamino)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone;oxalic acid |
| SMILES | CCOCCCNCC(=O)N1CCN(S(=O)(=O)c2ccc(C)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H29N3O4S.C2H2O4/c1-3-25-14-4-9-19-15-18(22)20-10-12-21(13-11-20)26(23,24)17-7-5-16(2)6-8-17;3-1(4)2(5)6/h5-8,19H,3-4,9-15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WYECIXJJYXFYDK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|