About 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione
1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione (PubChem CID 6448933) has the molecular formula C19H19F3N4O2
and a molecular weight of 392.38 g/mol. Its IUPAC name is 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione.
Molecular Properties
| Compound Name | 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione |
| PubChem CID | 6448933 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(/C=C/c3cccc(C(F)(F)F)c3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C19H19F3N4O2/c1-4-25-16-15(17(27)26(5-2)18(25)28)24(3)14(23-16)10-9-12-7-6-8-13(11-12)19(20,21)22/h6-11H,4-5H2,1-3H3/b10-9+ |
| InChIKey | NUIFAKZQWNPAII-MDZDMXLPSA-N |
| XLogP | 3.13 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione?
The IUPAC name of 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione (CID 6448933) is 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione.
What is the SMILES notation for 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione?
The canonical SMILES for 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione is CCn1c(=O)c2c(nc(/C=C/c3cccc(C(F)(F)F)c3)n2C)n(CC)c1=O.
What is the InChIKey of 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione?
The InChIKey is NUIFAKZQWNPAII-MDZDMXLPSA-N. The full InChI is InChI=1S/C19H19F3N4O2/c1-4-25-16-15(17(27)26(5-2)18(25)28)24(3)14(23-16)10-9-12-7-6-8-13(11-12)19(20,21)22/h6-11H,4-5H2,1-3H3/b10-9+.
What are the key properties of 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione?
1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione has a molecular weight of 392.38 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-7-methyl-8-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]purine-2,6-dione is sourced from PubChem (CID 6448933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).