About (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate
(E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate (PubChem CID 6449144) has the molecular formula C18H33NO6
and a molecular weight of 359.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate |
| PubChem CID | 6449144 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCN(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H29NO2.C4H4O4/c1-4-5-6-7-8-9-10-11-14(16)17-13-12-15(2)3;5-3(6)1-2-4(7)8/h4-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CAZDVHIUPQWANE-WLHGVMLRSA-N |
| XLogP | 2.94 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate?
The IUPAC name of (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate (CID 6449144) is (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate.
What is the SMILES notation for (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate?
The canonical SMILES for (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate is CCCCCCCCCC(=O)OCCN(C)C.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate?
The InChIKey is CAZDVHIUPQWANE-WLHGVMLRSA-N. The full InChI is InChI=1S/C14H29NO2.C4H4O4/c1-4-5-6-7-8-9-10-11-14(16)17-13-12-15(2)3;5-3(6)1-2-4(7)8/h4-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate?
(E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate has a molecular weight of 359.46 g/mol, XLogP of 2.94, 13 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;2-(dimethylamino)ethyl decanoate is sourced from PubChem (CID 6449144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).