C17H27N3O6 — CID 6449218
(E)-but-2-enedioic acid;1-[2-oxo-2-(4-propan-2-ylpiperazin-1-yl)ethyl]pyrrolidin-2-one (PubChem CID 6449218) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-oxo-2-(4-propan-2-ylpiperazin-1-yl)ethyl]pyrrolidin-2-one.
| Compound Name | (E)-but-2-enedioic acid;1-[2-oxo-2-(4-propan-2-ylpiperazin-1-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 6449218 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-oxo-2-(4-propan-2-ylpiperazin-1-yl)ethyl]pyrrolidin-2-one |
| SMILES | CC(C)N1CCN(C(=O)CN2CCCC2=O)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H23N3O2.C4H4O4/c1-11(2)14-6-8-15(9-7-14)13(18)10-16-5-3-4-12(16)17;5-3(6)1-2-4(7)8/h11H,3-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CKPQGQOFERMRSU-WLHGVMLRSA-N |
| XLogP | -0.13 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|