C27H30FN3O6 — CID 6449487
(E)-but-2-enedioic acid;2-[4-[2-(dimethylamino)propoxy]phenyl]-9-fluoro-4,4a,5,6-tetrahydrobenzo[h]cinnolin-3-one (PubChem CID 6449487) has the molecular formula C27H30FN3O6 and a molecular weight of 511.55 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[4-[2-(dimethylamino)propoxy]phenyl]-9-fluoro-4,4a,5,6-tetrahydrobenzo[h]cinnolin-3-one.
| Compound Name | (E)-but-2-enedioic acid;2-[4-[2-(dimethylamino)propoxy]phenyl]-9-fluoro-4,4a,5,6-tetrahydrobenzo[h]cinnolin-3-one |
|---|---|
| PubChem CID | 6449487 |
| Molecular Formula | C27H30FN3O6 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[4-[2-(dimethylamino)propoxy]phenyl]-9-fluoro-4,4a,5,6-tetrahydrobenzo[h]cinnolin-3-one |
| SMILES | CC(COc1ccc(N2N=C3c4cc(F)ccc4CCC3CC2=O)cc1)N(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H26FN3O2.C4H4O4/c1-15(26(2)3)14-29-20-10-8-19(9-11-20)27-22(28)12-17-5-4-16-6-7-18(24)13-21(16)23(17)25-27;5-3(6)1-2-4(7)8/h6-11,13,15,17H,4-5,12,14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PPLRPYJPMYFNDI-WLHGVMLRSA-N |
| XLogP | 3.57 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|